1-(3-azido-3-methoxypropyl)-4-methoxybenzene structure
|
Common Name | 1-(3-azido-3-methoxypropyl)-4-methoxybenzene | ||
|---|---|---|---|---|
| CAS Number | 114492-06-7 | Molecular Weight | 221.25600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H15N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(3-azido-3-methoxypropyl)-4-methoxybenzene |
|---|
| Molecular Formula | C11H15N3O2 |
|---|---|
| Molecular Weight | 221.25600 |
| Exact Mass | 221.11600 |
| PSA | 68.21000 |
| LogP | 2.36336 |
| InChIKey | ZVSRAOPOHMKTOY-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCC(N=[N+]=[N-])OC)cc1 |
|
~48%
1-(3-azido-3-me... CAS#:114492-06-7 |
| Literature: Amyes, Tina L.; Jencks, William P. Journal of the American Chemical Society, 1988 , vol. 110, p. 3677 - 3679 |
|
~%
1-(3-azido-3-me... CAS#:114492-06-7 |
| Literature: Amyes, Tina L.; Jencks, William P. Journal of the American Chemical Society, 1988 , vol. 110, p. 3677 - 3679 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |