4-Benzylbenzenesulfonamide structure
|
Common Name | 4-Benzylbenzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 1145-60-4 | Molecular Weight | 247.313 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 422.9±48.0 °C at 760 mmHg | |
| Molecular Formula | C13H13NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 209.6±29.6 °C | |
| Name | 4-benzylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 422.9±48.0 °C at 760 mmHg |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.313 |
| Flash Point | 209.6±29.6 °C |
| Exact Mass | 247.066696 |
| PSA | 68.54000 |
| LogP | 2.32 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | XIXRYMWTIKMPJU-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(Cc2ccccc2)cc1 |
| HS Code | 2935009090 |
|---|
|
~77%
4-Benzylbenzene... CAS#:1145-60-4 |
| Literature: Flaherty, Alice; Trunkfield, Amy; Barton, William Organic Letters, 2005 , vol. 7, # 22 p. 4975 - 4978 |
|
~%
4-Benzylbenzene... CAS#:1145-60-4 |
| Literature: Collection of Czechoslovak Chemical Communications, , vol. 29, p. 2161 - 2181 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| Benzenesulfonamide, 4-(phenylmethyl)- |
| 4-benzyl-benzenesulfonic acid amide |
| 4-Benzylbenzenesulfonamide |
| 4-Benzyl-benzolsulfonsaeure-amid |