N,N-dimethyl-4-(pyridin-4-ylmethylideneamino)aniline structure
|
Common Name | N,N-dimethyl-4-(pyridin-4-ylmethylideneamino)aniline | ||
|---|---|---|---|---|
| CAS Number | 1145-75-1 | Molecular Weight | 225.28900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-dimethyl-4-(pyridin-4-ylmethylideneamino)aniline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H15N3 |
|---|---|
| Molecular Weight | 225.28900 |
| Exact Mass | 225.12700 |
| PSA | 28.49000 |
| LogP | 2.89820 |
| InChIKey | LPMPLAUWYMTZIV-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(N=Cc2ccncc2)cc1 |
| HS Code | 2933399090 |
|---|
|
~%
N,N-dimethyl-4-... CAS#:1145-75-1 |
| Literature: Wong, Wai-Yeung; Wong, Wing-Tak Journal of Organometallic Chemistry, 1999 , vol. 584, # 1 p. 48 - 57 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AmbTos9877 |
| Pyridin-4-carboxyliden-p'-N,N-dimethylaminoanilin |