2-(2-methoxyanilino)pyridine-3-carboxylic acid structure
|
Common Name | 2-(2-methoxyanilino)pyridine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 114501-02-9 | Molecular Weight | 244.24600 | |
| Density | N/A | Boiling Point | 404.2ºC at 760mmHg | |
| Molecular Formula | C13H12N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.3ºC | |
| Name | 2-(2-methoxyanilino)pyridine-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 404.2ºC at 760mmHg |
|---|---|
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.24600 |
| Flash Point | 198.3ºC |
| Exact Mass | 244.08500 |
| PSA | 71.45000 |
| LogP | 2.60500 |
| Vapour Pressure | 2.92E-07mmHg at 25°C |
| InChIKey | BEXZOAJWOZFOSM-UHFFFAOYSA-N |
| SMILES | COc1ccccc1Nc1ncccc1C(=O)O |
| HS Code | 2933399090 |
|---|
|
~89%
2-(2-methoxyani... CAS#:114501-02-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 11 p. 2108 - 2121 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-[(2-methoxyphenyl)amino]pyridine-3-carboxylic acid |
| 2-(2-Methoxy-phenylamino)-nicotinic acid |
| 2-(o-methoxyanilino)nicotinic acid |
| 3-Pyridinecarboxylicacid,2-[(2-methoxyphenyl)amino] |