4-Methyl-2,6-diacetylpyridine structure
|
Common Name | 4-Methyl-2,6-diacetylpyridine | ||
|---|---|---|---|---|
| CAS Number | 114578-66-4 | Molecular Weight | 177.20000 | |
| Density | 1.093g/cm3 | Boiling Point | 320.6ºC at 760mmHg | |
| Molecular Formula | C10H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.1ºC | |
| Name | 1-(6-acetyl-4-methylpyridin-2-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.093g/cm3 |
|---|---|
| Boiling Point | 320.6ºC at 760mmHg |
| Molecular Formula | C10H11NO2 |
| Molecular Weight | 177.20000 |
| Flash Point | 152.1ºC |
| Exact Mass | 177.07900 |
| PSA | 47.03000 |
| LogP | 1.79520 |
| Vapour Pressure | 0.000314mmHg at 25°C |
| Index of Refraction | 1.519 |
| InChIKey | MILWOFXNHDEODM-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(C)cc(C(C)=O)n1 |
|
~83%
4-Methyl-2,6-di... CAS#:114578-66-4 |
| Literature: Gilchrist, Thomas L.; Hughes, Deborah; Stretch, Wayne; Chrystal, Ewan J. T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 2505 - 2510 |
|
~%
4-Methyl-2,6-di... CAS#:114578-66-4 |
| Literature: Gilchrist, Thomas L.; Hughes, Deborah; Stretch, Wayne; Chrystal, Ewan J. T. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 2505 - 2510 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,6-diacetyl-4-methylpyridine |
| 4-METHYL-2,6-DIACETYLPYRIDINE |