Heptanedinitrile,4-acetyl-4-phenyl- structure
|
Common Name | Heptanedinitrile,4-acetyl-4-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 1146-14-1 | Molecular Weight | 240.30000 | |
| Density | 1.079g/cm3 | Boiling Point | 466.5ºC at 760mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.9ºC | |
| Name | 4-acetyl-4-phenylheptanedinitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.079g/cm3 |
|---|---|
| Boiling Point | 466.5ºC at 760mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 235.9ºC |
| Exact Mass | 240.12600 |
| PSA | 64.65000 |
| LogP | 3.12096 |
| Vapour Pressure | 7.02E-09mmHg at 25°C |
| Index of Refraction | 1.52 |
| InChIKey | DSSSILUHCSFGGI-UHFFFAOYSA-N |
| SMILES | CC(=O)C(CCC#N)(CCC#N)c1ccccc1 |
|
~75%
Heptanedinitril... CAS#:1146-14-1 |
| Literature: Vives, Guillaume; Gonzalez, Alexandre; Jaud, Joel; Launay, Jean-Pierre; Rapenne, Gwenael Chemistry - A European Journal, 2007 , vol. 13, # 19 p. 5622 - 5631 |
|
~%
Heptanedinitril... CAS#:1146-14-1 |
| Literature: Bruson; Riener Journal of the American Chemical Society, 1942 , vol. 64, p. 2857 Journal of the American Chemical Society, 1943 , vol. 65, p. 21 |
| 3-Acetyl-3-phenyl-pentan-1,5-dicarbonitril |
| 4-Phenyl-4-acetyl-heptandisaeure-dinitril |
| 4-acetyl-4-phenyl-heptanedinitrile |
| 3-acetyl-1,5-dicyano-3-phenylpentane |
| 4-Phenyl-4-acetyl-pimelinsaeure-dinitril |
| 4-Acetyl-4-phenyl-heptandinitril |