5-furfuryl-5-isopropylbarbituric acid structure
|
Common Name | 5-furfuryl-5-isopropylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 1146-21-0 | Molecular Weight | 250.25100 | |
| Density | 1.253g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-(furan-2-ylmethyl)-5-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.253g/cm3 |
|---|---|
| Molecular Formula | C12H14N2O4 |
| Molecular Weight | 250.25100 |
| Exact Mass | 250.09500 |
| PSA | 95.39000 |
| LogP | 1.38230 |
| Index of Refraction | 1.52 |
| InChIKey | GPMGSASPWYMZHC-UHFFFAOYSA-N |
| SMILES | CC(C)C1(Cc2ccco2)C(=O)NC(=O)NC1=O |
| HS Code | 2934999090 |
|---|
|
~%
5-furfuryl-5-is... CAS#:1146-21-0 |
| Literature: Chem. Fabr. Wiernik and Co. Patent: DE630910 , 1933 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 23, p. 450 |
|
~%
5-furfuryl-5-is... CAS#:1146-21-0 |
| Literature: Chem. Fabr. Wiernik and Co. Patent: DE630910 , 1933 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 23, p. 450 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 214-549-0 |
| 5-furfuryl-5-isopropyl-pyrimidine-2,4,6-trione |
| 5-furfuryl-5-isopropyl-barbituric acid |
| 5-Furfuryl-5-isopropyl-barbitursaeure |
| dormovit |