Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate
Modify Date: 2026-07-07 19:06:51
![Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate Structure](https://www.chemsrc.com/extcaspic/392/1146292-48-9.png)
Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate structure
|
Common Name | Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate | ||
|---|---|---|---|---|
| CAS Number | 1146292-48-9 | Molecular Weight | 242.66 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H11ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H11ClN2O3 |
|---|---|
| Molecular Weight | 242.66 |
| InChIKey | SXFFLCNYDUZYLN-UHFFFAOYSA-N |
| SMILES | COC(=O)CNC(=O)Nc1cccc(Cl)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate? |
| A: Molecular weight of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate is 242.66. |
| Q: What is the InChIKey of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate? |
| A: InChIKey of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate is SXFFLCNYDUZYLN-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate? |
| A: Molecular formula of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate is C10H11ClN2O3. |
| Q: What is the SMILES notation of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate? |
| A: SMILES notation of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate is COC(=O)CNC(=O)Nc1cccc(Cl)c1. |
| Q: What is the English name of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate? |
| A: The English name of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate is Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate. |
| Q: What is the Chinese name of 1146292-48-9? |
| A: Chinese name of 1146292-48-9 is COC(=O)CNC(=O)Nc1cccc(Cl)c1. |
| Q: What is the CAS number of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate? |
| A: CAS number of Methyl 2-{[(3-chlorophenyl)carbamoyl]amino}acetate is 1146292-48-9. |