6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid structure
|
Common Name | 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1146292-92-3 | Molecular Weight | 203.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9N3O2 |
|---|---|
| Molecular Weight | 203.20 |
| InChIKey | DVJLPOSAQIDZLX-UHFFFAOYSA-N |
| SMILES | CCc1ccc2nnc(C(=O)O)nc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid? |
| A: Molecular weight of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid is 203.20. |
| Q: What is the SMILES notation of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid? |
| A: SMILES notation of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid is CCc1ccc2nnc(C(=O)O)nc2c1. |
| Q: What is the molecular formula of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid? |
| A: Molecular formula of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid is C10H9N3O2. |
| Q: What is the Chinese name of 1146292-92-3? |
| A: Chinese name of 1146292-92-3 is CCc1ccc2nnc(C(=O)O)nc2c1. |
| Q: What is the InChIKey of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid? |
| A: InChIKey of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid is DVJLPOSAQIDZLX-UHFFFAOYSA-N. |
| Q: What is the CAS number of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid? |
| A: CAS number of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid is 1146292-92-3. |
| Q: What is the English name of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid? |
| A: The English name of 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid is 6-Ethylbenzo[e][1,2,4]triazine-3-carboxylic acid. |