1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy
Modify Date: 2025-09-23 13:36:58
1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy structure
|
Common Name | 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy | ||
|---|---|---|---|---|
| CAS Number | 1146292-93-4 | Molecular Weight | 219.20 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H9N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H9N3O3 |
|---|---|
| Molecular Weight | 219.20 |
| InChIKey | MCJNYPHHSZTAEL-UHFFFAOYSA-N |
| SMILES | CCOc1ccc2nnc(C(=O)O)nc2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1146292-93-4? |
| A: Chinese name of 1146292-93-4 is CCOc1ccc2nnc(C(=O)O)nc2c1. |
| Q: What is the InChIKey of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy? |
| A: InChIKey of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy is MCJNYPHHSZTAEL-UHFFFAOYSA-N. |
| Q: What is the English name of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy? |
| A: The English name of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy is 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy. |
| Q: What is the CAS number of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy? |
| A: CAS number of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy is 1146292-93-4. |
| Q: What is the molecular weight of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy? |
| A: Molecular weight of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy is 219.20. |
| Q: What is the SMILES notation of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy? |
| A: SMILES notation of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy is CCOc1ccc2nnc(C(=O)O)nc2c1. |
| Q: What is the molecular formula of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy? |
| A: Molecular formula of 1,2,4-Benzotriazine-3-carboxylic acid, 6-ethoxy is C10H9N3O3. |