3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene
Modify Date: 2026-08-06 07:22:35
![3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene Structure](https://image.chemsrc.com/caspic/295/114635-97-1.png)
3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene structure
|
Common Name | 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 114635-97-1 | Molecular Weight | 226.36300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19FOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H19FOSi |
|---|---|
| Molecular Weight | 226.36300 |
| Exact Mass | 226.11900 |
| PSA | 9.23000 |
| LogP | 4.20970 |
| InChIKey | DWEBXSGLKNXUDW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)Oc1cccc(F)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 5 | |
CAS#:331-64-6
CAS#:405-09-4
CAS#:348-27-6
CAS#:78709-81-6
CAS#:54788-19-1This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: Polar surface area (PSA) of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene is 9.23000. |
| Q: What are the downstream products of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: Related downstream products(CAS) of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene: 331-64-6;405-09-4;348-27-6;78709-81-6;54788-19-1. |
| Q: What is the SMILES notation of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: SMILES notation of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene is CC(C)(C)[Si](C)(C)Oc1cccc(F)c1. |
| Q: What is the English name of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: The English name of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene is 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene. |
| Q: What is the CAS number of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: CAS number of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene is 114635-97-1. |
| Q: What is the molecular formula of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: Molecular formula of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene is C12H19FOSi. |
| Q: What is the molecular weight of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: Molecular weight of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene is 226.36300. |
| Q: What is the InChIKey of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: InChIKey of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene is DWEBXSGLKNXUDW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 114635-97-1? |
| A: Chinese name of 114635-97-1 is 114635-97-1. |
| Q: What is the LogP of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene? |
| A: LogP of 3-[(dimethyl-tert-butylsilyl)oxy]fluorobenzene is 4.20970. |