2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol
Modify Date: 2025-09-22 23:39:26
2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol structure
|
Common Name | 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol | ||
|---|---|---|---|---|
| CAS Number | 114673-98-2 | Molecular Weight | 314.37 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H26O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H26O6 |
|---|---|
| Molecular Weight | 314.37 |
| InChIKey | IPOIBBMZOXJYFV-UHFFFAOYSA-N |
| SMILES | C=C(C)C1CC=C(C)C(OC2OC(CO)C(O)C(O)C2O)C1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol? |
| A: SMILES notation of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol is C=C(C)C1CC=C(C)C(OC2OC(CO)C(O)C(O)C2O)C1. |
| Q: What is the Chinese name of 114673-98-2? |
| A: Chinese name of 114673-98-2 is 114673-98-2. |
| Q: What is the molecular formula of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol? |
| A: Molecular formula of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol is C16H26O6. |
| Q: What is the molecular weight of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol? |
| A: Molecular weight of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol is 314.37. |
| Q: What is the InChIKey of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol? |
| A: InChIKey of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol is IPOIBBMZOXJYFV-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol? |
| A: The English name of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol is 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol. |
| Q: What is the CAS number of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol? |
| A: CAS number of 2-(Hydroxymethyl)-6-(2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-yl)oxyoxane-3,4,5-triol is 114673-98-2. |