Propyl-3-methylimidazolium hydrogen sulfate
Modify Date: 2026-07-14 20:31:43
Propyl-3-methylimidazolium hydrogen sulfate structure
|
Common Name | Propyl-3-methylimidazolium hydrogen sulfate | ||
|---|---|---|---|---|
| CAS Number | 1147339-29-4 | Molecular Weight | 222.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Propyl-3-methylimidazolium hydrogen sulfate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C7H14N2O4S |
|---|---|
| Molecular Weight | 222.26 |
| InChIKey | QZAYYSZSURXQBB-UHFFFAOYSA-M |
| SMILES | CCCn1cc[n+](C)c1.O=S(=O)([O-])O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1147339-29-4? |
| A: Chinese name of 1147339-29-4 is 1147339-29-4. |
| Q: What is the SMILES notation of Propyl-3-methylimidazolium hydrogen sulfate? |
| A: SMILES notation of Propyl-3-methylimidazolium hydrogen sulfate is CCCn1cc[n+](C)c1.O=S(=O)([O-])O. |
| Q: What is the English name of Propyl-3-methylimidazolium hydrogen sulfate? |
| A: The English name of Propyl-3-methylimidazolium hydrogen sulfate is Propyl-3-methylimidazolium hydrogen sulfate. |
| Q: What is the InChIKey of Propyl-3-methylimidazolium hydrogen sulfate? |
| A: InChIKey of Propyl-3-methylimidazolium hydrogen sulfate is QZAYYSZSURXQBB-UHFFFAOYSA-M. |
| Q: What is the CAS number of Propyl-3-methylimidazolium hydrogen sulfate? |
| A: CAS number of Propyl-3-methylimidazolium hydrogen sulfate is 1147339-29-4. |
| Q: What is the molecular formula of Propyl-3-methylimidazolium hydrogen sulfate? |
| A: Molecular formula of Propyl-3-methylimidazolium hydrogen sulfate is C7H14N2O4S. |
| Q: What is the molecular weight of Propyl-3-methylimidazolium hydrogen sulfate? |
| A: Molecular weight of Propyl-3-methylimidazolium hydrogen sulfate is 222.26. |