tert-Butyl-4'-(methyl)biphenyl-2-carboxylate structure
|
Common Name | tert-Butyl-4'-(methyl)biphenyl-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 114772-36-0 | Molecular Weight | 268.35000 | |
| Density | 1.038g/cm3 | Boiling Point | 388.892ºC at 760 mmHg | |
| Molecular Formula | C18H20O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 162.608ºC | |
| Name | tert-butyl 2-(4-methylphenyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.038g/cm3 |
|---|---|
| Boiling Point | 388.892ºC at 760 mmHg |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.35000 |
| Flash Point | 162.608ºC |
| Exact Mass | 268.14600 |
| PSA | 26.30000 |
| LogP | 4.61730 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | OWEDFWZJRNPJIV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2ccccc2C(=O)OC(C)(C)C)cc1 |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| TERT-BUTYL 4'-METHYLBIPHENYL-2-CARBOXYLATE |
| tert-butyl 4'-methyl-2-biphenylcarboxylate |
| 2-t-butoxycarbonyl-4'-methylbiphenyl |
| 1,1-Dimethylethyl 4'-methylbiphenyl-2-carboxylate |
| MFCD04973964 |