2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine
Modify Date: 2026-09-30 09:02:27
![2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine Structure](https://www.chemsrc.com/extcaspic/134/1147894-75-4.png)
2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine structure
|
Common Name | 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine | ||
|---|---|---|---|---|
| CAS Number | 1147894-75-4 | Molecular Weight | 287.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H21N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C21H21N |
|---|---|
| Molecular Weight | 287.4 |
| InChIKey | IRQXOKPIIHJQEW-UHFFFAOYSA-N |
| SMILES | CC(C)Cc1ccc(-c2cccc(-c3ccccc3)c2)nc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine? |
| A: SMILES notation of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine is CC(C)Cc1ccc(-c2cccc(-c3ccccc3)c2)nc1. |
| Q: What is the molecular formula of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine? |
| A: Molecular formula of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine is C21H21N. |
| Q: What is the InChIKey of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine? |
| A: InChIKey of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine is IRQXOKPIIHJQEW-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1147894-75-4? |
| A: Chinese name of 1147894-75-4 is 1147894-75-4. |
| Q: What is the molecular weight of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine? |
| A: Molecular weight of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine is 287.4. |
| Q: What is the CAS number of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine? |
| A: CAS number of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine is 1147894-75-4. |
| Q: What is the English name of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine? |
| A: The English name of 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine is 2-([1,1'-Biphenyl]-3-yl)-5-isobutylpyridine. |