(2-Chloro-4-nitrophenyl)phosphonic acid structure
|
Common Name | (2-Chloro-4-nitrophenyl)phosphonic acid | ||
|---|---|---|---|---|
| CAS Number | 114792-24-4 | Molecular Weight | 237.53400 | |
| Density | 1.76g/cm3 | Boiling Point | 470.1ºC at 760 mmHg | |
| Molecular Formula | C6H5ClNO5P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 238.1ºC | |
| Name | (2-Chloro-4-nitrophenyl)phosphonic acid |
|---|
| Density | 1.76g/cm3 |
|---|---|
| Boiling Point | 470.1ºC at 760 mmHg |
| Molecular Formula | C6H5ClNO5P |
| Molecular Weight | 237.53400 |
| Flash Point | 238.1ºC |
| Exact Mass | 236.95900 |
| PSA | 113.16000 |
| LogP | 1.57440 |
| Vapour Pressure | 1.21E-09mmHg at 25°C |
| Index of Refraction | 1.624 |
| InChIKey | PCWPSLCPIKEDCV-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(P(=O)(O)O)c(Cl)c1 |
|
~%
(2-Chloro-4-nit... CAS#:114792-24-4 |
| Literature: Freedman et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 1379,1380 Journal of the American Chemical Society, 1957 , vol. 79, p. 6575 Errata |