2-amino-9-[3-hydroxy-2-(hydroxymethyl)propoxy]-3H-purin-6-one structure
|
Common Name | 2-amino-9-[3-hydroxy-2-(hydroxymethyl)propoxy]-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 114809-39-1 | Molecular Weight | 255.23100 | |
| Density | 1.81g/cm3 | Boiling Point | 615.9ºC at 760 mmHg | |
| Molecular Formula | C9H13N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 326.3ºC | |
| Name | 2-amino-9-[3-hydroxy-2-(hydroxymethyl)propoxy]-3H-purin-6-one |
|---|
| Density | 1.81g/cm3 |
|---|---|
| Boiling Point | 615.9ºC at 760 mmHg |
| Molecular Formula | C9H13N5O4 |
| Molecular Weight | 255.23100 |
| Flash Point | 326.3ºC |
| Exact Mass | 255.09700 |
| PSA | 140.27000 |
| Vapour Pressure | 5.03E-16mmHg at 25°C |
| Index of Refraction | 1.76 |
| InChIKey | LGERQLHLISVRPT-UHFFFAOYSA-N |
| SMILES | Nc1nc2c(ncn2OCC(CO)CO)c(=O)[nH]1 |
|
~31%
2-amino-9-[3-hy... CAS#:114809-39-1 |
| Literature: Beecham Group p.l.c. Patent: US4965270 A1, 1990 ; |
|
~45%
2-amino-9-[3-hy... CAS#:114809-39-1 |
| Literature: Harnden; Wyatt; Boyd; Sutton Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 187 - 196 |
|
~%
2-amino-9-[3-hy... CAS#:114809-39-1 |
| Literature: Harnden; Wyatt; Boyd; Sutton Journal of Medicinal Chemistry, 1990 , vol. 33, # 1 p. 187 - 196 |