2,6-Diethyl-4-oxo-piperidine-1-carboxylic acid tert-butyl ester structure
|
Common Name | 2,6-Diethyl-4-oxo-piperidine-1-carboxylic acid tert-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 1148130-16-8 | Molecular Weight | 255.353 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 340.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H25NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 160.0±25.9 °C | |
| Name | tert-butyl 2,6-diethyl-4-oxopiperidine-1-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 340.9±35.0 °C at 760 mmHg |
| Molecular Formula | C14H25NO3 |
| Molecular Weight | 255.353 |
| Flash Point | 160.0±25.9 °C |
| Exact Mass | 255.183441 |
| PSA | 46.61000 |
| LogP | 2.43 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.460 |
| InChIKey | PRRQDRLRMZGMRO-UHFFFAOYSA-N |
| SMILES | CCC1CC(=O)CC(CC)N1C(=O)OC(C)(C)C |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperidinecarboxylic acid, 2,6-diethyl-4-oxo-, 1,1-dimethylethyl ester |
| 2,6-diethyl-4-oxo-piperidine-1-carboxylic acid tert-butyl ester |
| N-boc-2,6-diethyl-4-oxo-piperidine |
| 2-Methyl-2-propanyl 2,6-diethyl-4-oxo-1-piperidinecarboxylate |
| N-Boc-2,6-diethyl-4-oxo-piperdine |