2-Propenyl 2-Deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)--D-glucopyranoside structure
|
Common Name | 2-Propenyl 2-Deoxy-2-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)--D-glucopyranoside | ||
|---|---|---|---|---|
| CAS Number | 114853-29-1 | Molecular Weight | 349.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H19NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[(2R,4R,5S)-4,5-dihydroxy-6-(hydroxymethyl)-2-prop-2-enoxyoxan-3-yl]isoindole-1,3-dione |
|---|
| Molecular Formula | C17H19NO7 |
|---|---|
| Molecular Weight | 349.33500 |
| Exact Mass | 349.11600 |
| PSA | 116.53000 |
| Index of Refraction | 1.646 |
| InChIKey | ZPZAUIIISMQKHG-BIBNWMFVSA-N |
| SMILES | C=CCOC1OC(CO)C(O)C(O)C1N1C(=O)c2ccccc2C1=O |
|
~91%
2-Propenyl 2-De... CAS#:114853-29-1 |
| Literature: Wang, Lai-Xi; Li, Chuan; Wang, Qin-Wei; Hui, Yong-Zheng Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1994 , # 6 p. 621 - 628 |
|
~%
2-Propenyl 2-De... CAS#:114853-29-1 |
| Literature: Journal of Carbohydrate Chemistry, , vol. 13, # 5 p. 819 - 824 |
|
~%
2-Propenyl 2-De... CAS#:114853-29-1 |
| Literature: WO2011/133227 A2, ; |
|
~%
2-Propenyl 2-De... CAS#:114853-29-1 |
| Literature: Journal of Carbohydrate Chemistry, , vol. 13, # 5 p. 819 - 824 |
|
~%
2-Propenyl 2-De... CAS#:114853-29-1 |
| Literature: WO2011/133227 A2, ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |