(R,S)-Carvedilol Glucuronide structure
|
Common Name | (R,S)-Carvedilol Glucuronide | ||
|---|---|---|---|---|
| CAS Number | 114869-83-9 | Molecular Weight | 582.59800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H34N2O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,3S,4S,5R,6R)-6-[1-(9H-carbazol-4-yloxy)-3-[2-(2-methoxyphenoxy)ethylamino]propan-2-yl]oxy-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C30H34N2O10 |
|---|---|
| Molecular Weight | 582.59800 |
| Exact Mass | 582.22100 |
| PSA | 171.96000 |
| LogP | 2.04540 |
| Index of Refraction | 1.69 |
| InChIKey | PUVQFGCELBOSRN-VKTJNCFWSA-N |
| SMILES | COc1ccccc1OCCNCC(COc1cccc2[nH]c3ccccc3c12)OC1OC(C(=O)O)C(O)C(O)C1O |
| Carvedilol |A-D-Glucuronide (mixture of diasteromers) |
| Carvedilol Beta-D-Glucuronide |
| Carvedilol Glucuronide |
| 2-(9H-Carbazol-4-yloxy)-1-[[[2-(2-methoxyphenoxy)ethyl]amino]methyl]ethyl |A-D-Glucopyranosiduronic Acid |