N-(tert-Butoxycarbonyl)-5-chloro-L-tryptophan structure
|
Common Name | N-(tert-Butoxycarbonyl)-5-chloro-L-tryptophan | ||
|---|---|---|---|---|
| CAS Number | 114873-08-4 | Molecular Weight | 338.786 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 560.8±50.0 °C at 760 mmHg | |
| Molecular Formula | C16H19ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 292.9±30.1 °C | |
| Name | (2S)-3-(5-chloro-1H-indol-3-yl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 560.8±50.0 °C at 760 mmHg |
| Molecular Formula | C16H19ClN2O4 |
| Molecular Weight | 338.786 |
| Flash Point | 292.9±30.1 °C |
| Exact Mass | 338.103333 |
| PSA | 91.42000 |
| LogP | 3.67 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | PZZXAZAYKCNQAL-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)NC(Cc1c[nH]c2ccc(Cl)cc12)C(=O)O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-Tryptophan, 5-chloro-N-[(1,1-dimethylethoxy)carbonyl]- |
| 5-Chloro-N-{[(2-methyl-2-propanyl)oxy]carbonyl}-L-tryptophan |
| N-(tert-Butoxycarbonyl)-5-chloro-L-tryptophan |
| Boc-5-Chloro-L-tryptophan |