1-(4-Methoxybenzylidene)-2-benzylidenehydrazine structure
|
Common Name | 1-(4-Methoxybenzylidene)-2-benzylidenehydrazine | ||
|---|---|---|---|---|
| CAS Number | 1149-69-5 | Molecular Weight | 238.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[(4-methoxyphenyl)methylideneamino]-1-phenylmethanimine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H14N2O |
|---|---|
| Molecular Weight | 238.28400 |
| Exact Mass | 238.11100 |
| PSA | 33.95000 |
| LogP | 3.14820 |
| InChIKey | IGKAMOVQZRNZIR-UHFFFAOYSA-N |
| SMILES | COc1ccc(C=NN=Cc2ccccc2)cc1 |
| HS Code | 2928000090 |
|---|
|
~%
1-(4-Methoxyben... CAS#:1149-69-5 |
| Literature: Zhongjiao; Weiguo; Weiqi; Jiajun Synthetic Communications, 2001 , vol. 31, # 1 p. 125 - 129 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Benzyliden-<4-methoxy-benzyliden>-hydrazin |
| 4-Methoxybenzalazin |
| 4-Methoxy-benzaldazin |