N-benzyl-1-phenylmethanamine,4-methylbenzenesulfonic acid structure
|
Common Name | N-benzyl-1-phenylmethanamine,4-methylbenzenesulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 114910-42-8 | Molecular Weight | 369.47700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H23NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-benzyl-1-phenylmethanamine,4-methylbenzenesulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H23NO3S |
|---|---|
| Molecular Weight | 369.47700 |
| Exact Mass | 369.14000 |
| PSA | 74.78000 |
| LogP | 5.68980 |
| InChIKey | TXLIWDSKGBSZNL-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.c1ccc(CNCc2ccccc2)cc1 |
|
~89%
N-benzyl-1-phen... CAS#:114910-42-8 |
| Literature: Gibson, Harry W.; Jones, Jason W.; Zakharov, Lev N.; Rheingold, Arnold L.; Slebodnick, Carla Chemistry - A European Journal, 2011 , vol. 17, # 11 p. 3192 - 3206 |
|
~%
N-benzyl-1-phen... CAS#:114910-42-8 |
| Literature: Tokunaga, Yuji; Yoshioka, Megumi; Nakamura, Tatsuya; Goda, Tatsuhiro; Nakata, Ryuji; Kakuchi, Suzuka; Shimomura, Youji Bulletin of the Chemical Society of Japan, 2007 , vol. 80, # 7 p. 1377 - 1382 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| dibenzylammonium tosylate |
| Dibenzyl-amin,Toluol-4-sulfonat |
| dibenzyl-amine,toluene-4-sulfonate |
| dibenzylammonium p-toluenesulfonate |