[2-(benzenesulfonyl)-2-fluoroethyl]sulfanylbenzene structure
|
Common Name | [2-(benzenesulfonyl)-2-fluoroethyl]sulfanylbenzene | ||
|---|---|---|---|---|
| CAS Number | 114969-04-9 | Molecular Weight | 296.38000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H13FO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(benzenesulfonyl)-2-fluoroethyl]sulfanylbenzene |
|---|
| Molecular Formula | C14H13FO2S2 |
|---|---|
| Molecular Weight | 296.38000 |
| Exact Mass | 296.03400 |
| PSA | 67.82000 |
| LogP | 4.62900 |
| InChIKey | UAWKTOQEHWLCRO-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)C(F)CSc1ccccc1 |
|
~87%
[2-(benzenesulf... CAS#:114969-04-9 |
| Literature: Koizumi, Toru; Hagi, Toru; Horie, Yoshiharu; Takeuchi, Yoshio Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 9 p. 3959 - 3962 |
|
~%
[2-(benzenesulf... CAS#:114969-04-9 |
| Literature: Koizumi, Toru; Hagi, Toru; Horie, Yoshiharu; Takeuchi, Yoshio Chemical and Pharmaceutical Bulletin, 1987 , vol. 35, # 9 p. 3959 - 3962 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |