methyl 6-(bromomethyl)-2-hydroxy-4-methoxy-3-methylbenzoate structure
|
Common Name | methyl 6-(bromomethyl)-2-hydroxy-4-methoxy-3-methylbenzoate | ||
|---|---|---|---|---|
| CAS Number | 114973-01-2 | Molecular Weight | 289.12300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13BrO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 6-(bromomethyl)-2-hydroxy-4-methoxy-3-methylbenzoate |
|---|
| Molecular Formula | C11H13BrO4 |
|---|---|
| Molecular Weight | 289.12300 |
| Exact Mass | 288.00000 |
| PSA | 55.76000 |
| LogP | 2.39070 |
| InChIKey | JKDIFVPWBPFFLP-UHFFFAOYSA-N |
| SMILES | COC(=O)c1c(CBr)cc(OC)c(C)c1O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |