Tachysterol
Tachysterol structure
|
Common Name | Tachysterol | ||
|---|---|---|---|---|
| CAS Number | 115-61-7 | Molecular Weight | 396.64800 | |
| Density | 1.02g/cm3 | Boiling Point | 503.8ºC at 760mmHg | |
| Molecular Formula | C28H44O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.1ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.02g/cm3 |
|---|---|
| Boiling Point | 503.8ºC at 760mmHg |
| Molecular Formula | C28H44O |
| Molecular Weight | 396.64800 |
| Flash Point | 218.1ºC |
| Exact Mass | 396.33900 |
| PSA | 20.23000 |
| LogP | 7.64100 |
| Vapour Pressure | 2.94E-12mmHg at 25°C |
| Index of Refraction | 1.582 |
| InChIKey | XQFJZHAVTPYDIQ-LETJEVNCSA-N |
| SMILES | CC1=C(C=CC2=CCCC3(C)C2CCC3C(C)C=CC(C)C(C)C)CC(O)CC1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:50-14-6
CAS#:67-96-9
CAS#:104396-98-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tacedinaline |
| Goe 5549 |
| tachysterol |
| Tachysterol2 |
| EINECS 204-096-7 |
| N-acetyldinaline |
| Acetyldinaline |
| Tacedinalina |
| taxisterol2 |
| Tachysterin2 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: Related downstream products(CAS) of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol: 50-14-6;67-96-9;104396-98-7. |
| Q: What is the molecular weight of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: Molecular weight of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol is 396.64800. |
| Q: What English synonyms does (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol have? |
| A: English synonyms of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol: tacedinaline, Goe 5549, tachysterol, Tachysterol2, EINECS 204-096-7, N-acetyldinaline, Acetyldinaline, Tacedinalina, taxisterol2, Tachysterin2. |
| Q: What is the CAS number of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: CAS number of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol is 115-61-7. |
| Q: What is the molecular formula of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: Molecular formula of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol is C28H44O. |
| Q: What is the boiling point of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: Boiling point of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol is 503.8ºC at 760mmHg. |
| Q: What is the LogP of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: LogP of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol is 7.64100. |
| Q: What is the polar surface area (PSA) of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: Polar surface area (PSA) of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol is 20.23000. |
| Q: What is the InChIKey of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: InChIKey of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol is XQFJZHAVTPYDIQ-LETJEVNCSA-N. |
| Q: What is the SMILES notation of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol? |
| A: SMILES notation of (3S,6E,22E)-9,10-Secoergosta-5(10),6,8,22-tetraen-3-ol is CC1=C(C=CC2=CCCC3(C)C2CCC3C(C)C=CC(C)C(C)C)CC(O)CC1. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |