Phosphoric acid,bis[4-(1,1-dimethylethyl)phenyl] phenyl ester structure
|
Common Name | Phosphoric acid,bis[4-(1,1-dimethylethyl)phenyl] phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 115-87-7 | Molecular Weight | 438.49600 | |
| Density | 1.12g/cm3 | Boiling Point | 477.3ºC at 760mmHg | |
| Molecular Formula | C26H31O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 255.7ºC | |
| Name | bis(4-tert-butylphenyl) phenyl phosphate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 477.3ºC at 760mmHg |
| Molecular Formula | C26H31O4P |
| Molecular Weight | 438.49600 |
| Flash Point | 255.7ºC |
| Exact Mass | 438.19600 |
| PSA | 54.57000 |
| LogP | 7.92650 |
| Vapour Pressure | 8.16E-09mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | PDLPMCXGPIVYQQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OP(=O)(Oc2ccccc2)Oc2ccc(C(C)(C)C)cc2)cc1 |
| HS Code | 2919900090 |
|---|
|
~%
Phosphoric acid... CAS#:115-87-7 |
| Literature: Dow Chem. Co. Patent: US2071323 , 1935 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2919900090 |
|---|---|
| Summary | 2919900090 other phosphoric esters and their salts, including lactophosphates; their halogenated, sulphonated, nitrated or nitrosated derivatives。supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward)。VAT:17.0%。tax rebate rate:9.0%。MFN tariff:6.5%。general tariff:30.0% |
| Phenyl Di-p-tert-butylphenyl Phosphate |