Di-tert-butyl-2,6-diazaspiro[3.3]heptan-2,6-dicarboxylat structure
|
Common Name | Di-tert-butyl-2,6-diazaspiro[3.3]heptan-2,6-dicarboxylat | ||
|---|---|---|---|---|
| CAS Number | 1150618-17-9 | Molecular Weight | 298.378 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 379.0±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H26N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.0±27.9 °C | |
| Name | ditert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 379.0±42.0 °C at 760 mmHg |
| Molecular Formula | C15H26N2O4 |
| Molecular Weight | 298.378 |
| Flash Point | 183.0±27.9 °C |
| Exact Mass | 298.189270 |
| PSA | 59.08000 |
| LogP | 1.74 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | ONCGJNFACJSGIN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC2(C1)CN(C(=O)OC(C)(C)C)C2 |
| HS Code | 2933990090 |
|---|
|
~%
Di-tert-butyl-2... CAS#:1150618-17-9 |
| Literature: MERCK FROSST CANADA LTD.; LACHANCE, Nicolas; LEGER, Serge; OBALLA, Renata, M.; POWELL, David; TRANMER, Geoffrey, K.; MARTINS, Evelyn; GAREAU, Yves Patent: WO2010/108268 A1, 2010 ; Location in patent: Page/Page column 68-69 ; WO 2010/108268 A1 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Bis(2-methyl-2-propanyl) 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate |
| di-tert-butyl 2,6-diazaspiro[3.3]heptane-2,6-dicarboxylate |
| Di-tert-butyl-2,6-diazaspiro[3.3]heptan-2,6-dicarboxylat |
| 2,6-Diazaspiro[3.3]heptane-2,6-dicarboxylic acid, bis(1,1-dimethylethyl) ester |