Benzoic acid,2-(2-methoxybenzoyl)- structure
|
Common Name | Benzoic acid,2-(2-methoxybenzoyl)- | ||
|---|---|---|---|---|
| CAS Number | 1151-04-8 | Molecular Weight | 256.25300 | |
| Density | 1.255g/cm3 | Boiling Point | 494.2ºC at 760mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.5ºC | |
| Name | 2-(2-methoxybenzoyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.255g/cm3 |
|---|---|
| Boiling Point | 494.2ºC at 760mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 190.5ºC |
| Exact Mass | 256.07400 |
| PSA | 63.60000 |
| LogP | 2.62440 |
| Vapour Pressure | 1.39E-10mmHg at 25°C |
| Index of Refraction | 1.598 |
| InChIKey | FDRBINAKYXMDSC-UHFFFAOYSA-N |
| SMILES | COc1ccccc1C(=O)c1ccccc1C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| o,o'-Methoxybenzoyl-benzoesaeure |
| Benzophenone,2-carboxy-2'-methoxy |