quinidine, dihydrochloride, compound with resorcinol
Modify Date: 2025-09-18 18:15:39
quinidine, dihydrochloride, compound with resorcinol structure
|
Common Name | quinidine, dihydrochloride, compound with resorcinol | ||
|---|---|---|---|---|
| CAS Number | 115160-11-7 | Molecular Weight | 470.98800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H31ClN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | quinidine, dihydrochloride, compound with resorcinol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C26H31ClN2O4 |
|---|---|
| Molecular Weight | 470.98800 |
| Exact Mass | 470.19700 |
| PSA | 86.05000 |
| LogP | 5.01090 |
| InChIKey | FKPRJAFCZNCGJZ-UHFFFAOYSA-N |
| SMILES | C=CC1CN2CCC1CC2C(O)c1ccnc2ccc(OC)cc12.Cl.Oc1cccc(O)c1 |
| Chinidin, dihydrochlorid, Verbindung mit Resorcin |