3,3,3-Trifluoropropylphenyl sulfone
Modify Date: 2026-07-31 19:51:45
3,3,3-Trifluoropropylphenyl sulfone structure
|
Common Name | 3,3,3-Trifluoropropylphenyl sulfone | ||
|---|---|---|---|---|
| CAS Number | 115178-99-9 | Molecular Weight | 238.23 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H9F3O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,3-Trifluoropropylphenyl sulfone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H9F3O2S |
|---|---|
| Molecular Weight | 238.23 |
| InChIKey | WRYKWIRVEHMAID-UHFFFAOYSA-N |
| SMILES | O=S(=O)(CCC(F)(F)F)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3,3,3-Trifluoropropylphenyl sulfone? |
| A: The English name of 3,3,3-Trifluoropropylphenyl sulfone is 3,3,3-Trifluoropropylphenyl sulfone. |
| Q: What is the molecular weight of 3,3,3-Trifluoropropylphenyl sulfone? |
| A: Molecular weight of 3,3,3-Trifluoropropylphenyl sulfone is 238.23. |
| Q: What is the InChIKey of 3,3,3-Trifluoropropylphenyl sulfone? |
| A: InChIKey of 3,3,3-Trifluoropropylphenyl sulfone is WRYKWIRVEHMAID-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 3,3,3-Trifluoropropylphenyl sulfone? |
| A: SMILES notation of 3,3,3-Trifluoropropylphenyl sulfone is O=S(=O)(CCC(F)(F)F)c1ccccc1. |
| Q: What is the Chinese name of 115178-99-9? |
| A: Chinese name of 115178-99-9 is 115178-99-9. |
| Q: What is the molecular formula of 3,3,3-Trifluoropropylphenyl sulfone? |
| A: Molecular formula of 3,3,3-Trifluoropropylphenyl sulfone is C9H9F3O2S. |
| Q: What is the CAS number of 3,3,3-Trifluoropropylphenyl sulfone? |
| A: CAS number of 3,3,3-Trifluoropropylphenyl sulfone is 115178-99-9. |