(1R)-1-ethyl-2-(4-hydroxyphenyl)-3-methyl-1H-inden-5-ol structure
|
Common Name | (1R)-1-ethyl-2-(4-hydroxyphenyl)-3-methyl-1H-inden-5-ol | ||
|---|---|---|---|---|
| CAS Number | 115217-05-5 | Molecular Weight | 266.33400 | |
| Density | 1.176g/cm3 | Boiling Point | 450.2ºC at 760mmHg | |
| Molecular Formula | C18H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | (1R)-1-ethyl-2-(4-hydroxyphenyl)-3-methyl-1H-inden-5-ol |
|---|
| Density | 1.176g/cm3 |
|---|---|
| Boiling Point | 450.2ºC at 760mmHg |
| Molecular Formula | C18H18O2 |
| Molecular Weight | 266.33400 |
| Flash Point | 213.5ºC |
| Exact Mass | 266.13100 |
| PSA | 40.46000 |
| LogP | 4.53570 |
| Vapour Pressure | 1.01E-08mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | HJVFIQKBLPQQDY-OAHLLOKOSA-N |
| SMILES | CCC1C(c2ccc(O)cc2)=C(C)c2cc(O)ccc21 |
|
~%
(1R)-1-ethyl-2-... CAS#:115217-05-5 |
| Literature: Oda; Sakakibara; Sato; Hanzawa; Hata Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 3 p. 588 - 592 |
|
~%
(1R)-1-ethyl-2-... CAS#:115217-05-5 |
| Literature: Oda; Sakakibara; Sato; Hanzawa; Hata Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 3 p. 588 - 592 |
|
~%
(1R)-1-ethyl-2-... CAS#:115217-05-5 |
| Literature: Oda; Sakakibara; Sato; Hanzawa; Hata Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 3 p. 588 - 592 |
|
~%
(1R)-1-ethyl-2-... CAS#:115217-05-5 |
| Literature: Oda; Sakakibara; Sato; Hanzawa; Hata Chemical and Pharmaceutical Bulletin, 1992 , vol. 40, # 3 p. 588 - 592 |