3-(dimethylamino)-N-[4-[3-(dimethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide,dihydrochloride structure
|
Common Name | 3-(dimethylamino)-N-[4-[3-(dimethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide,dihydrochloride | ||
|---|---|---|---|---|
| CAS Number | 115290-32-9 | Molecular Weight | 509.42500 | |
| Density | N/A | Boiling Point | 701.5ºC at 760mmHg | |
| Molecular Formula | C24H30Cl2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 378.1ºC | |
| Name | 3-(dimethylamino)-N-[4-[3-(dimethylamino)propanoylamino]-9,10-dioxoanthracen-1-yl]propanamide,dihydrochloride |
|---|
| Boiling Point | 701.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C24H30Cl2N4O4 |
| Molecular Weight | 509.42500 |
| Flash Point | 378.1ºC |
| Exact Mass | 508.16400 |
| PSA | 105.80000 |
| LogP | 5.14540 |
| Vapour Pressure | 1.58E-19mmHg at 25°C |
| InChIKey | GCOVHCFVWVUAOU-UHFFFAOYSA-N |
| SMILES | CN(C)CCC(=O)Nc1ccc(NC(=O)CCN(C)C)c2c1C(=O)c1ccccc1C2=O.Cl.Cl |
|
~80%
3-(dimethylamin... CAS#:115290-32-9 |
| Literature: Martelli; Dzieduszycka; Stefanska; Bontemps-Gracz; Borowski Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 1956 - 1959 |
|
~%
3-(dimethylamin... CAS#:115290-32-9 |
| Literature: Martelli; Dzieduszycka; Stefanska; Bontemps-Gracz; Borowski Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 1956 - 1959 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |