Kanshone B structure
|
Common Name | Kanshone B | ||
|---|---|---|---|---|
| CAS Number | 115370-61-1 | Molecular Weight | 266.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Kanshone BKanshone B (Compound 5) is isolated from the natural Nardostachys chinensis. Kanshone B shows inhibitoryactivity against LPS-induced NO production (IC50=11.5 μM)[1]. |
| Name | 5H-Naphtho[2,1-c][1,2]dioxol-5-one,1,3a,4,7,8,9,9a,9b-octahydro-7-hydroxy-1,1,9,9a-tetramethyl-,(3aR,7R,9R,9aR,9bS)- |
|---|---|
| Synonym | More Synonyms |
| Description | Kanshone B (Compound 5) is isolated from the natural Nardostachys chinensis. Kanshone B shows inhibitoryactivity against LPS-induced NO production (IC50=11.5 μM)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C15H22O4 |
|---|---|
| Molecular Weight | 266.33 |
| InChIKey | QLASPINFLLNESN-UVBAXCRRSA-N |
| SMILES | CC1CC(O)C=C2C(=O)CC3OOC(C)(C)C3C21C |
| Storage condition | 2-8℃ |
| Kanshone B |