3-[4-nitro-2-(trifluoromethyl)anilino]propan-1-ol structure
|
Common Name | 3-[4-nitro-2-(trifluoromethyl)anilino]propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 115416-49-4 | Molecular Weight | 264.20100 | |
| Density | 1.429g/cm3 | Boiling Point | 389.4ºC at 760 mmHg | |
| Molecular Formula | C10H11F3N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 189.3ºC | |
| Name | 3-[4-nitro-2-(trifluoromethyl)anilino]propan-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 389.4ºC at 760 mmHg |
| Molecular Formula | C10H11F3N2O3 |
| Molecular Weight | 264.20100 |
| Flash Point | 189.3ºC |
| Exact Mass | 264.07200 |
| PSA | 78.08000 |
| LogP | 3.00410 |
| Vapour Pressure | 9.26E-07mmHg at 25°C |
| Index of Refraction | 1.542 |
| InChIKey | KLTFJGOLYNHARU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(NCCCO)c(C(F)(F)F)c1 |
| HS Code | 2922199090 |
|---|
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| hms2565j03 |