1-(3,5-dimethylphenyl)cyclobutane-1-carbonitrile structure
|
Common Name | 1-(3,5-dimethylphenyl)cyclobutane-1-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 1154178-68-3 | Molecular Weight | 185.26 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 315.6±21.0 °C at 760 mmHg | |
| Molecular Formula | C13H15N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.9±14.8 °C | |
Use of 1-(3,5-dimethylphenyl)cyclobutane-1-carbonitrileFree bass |
| Name | 1-(3,5-dimethylphenyl)cyclobutane-1-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 315.6±21.0 °C at 760 mmHg |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.26 |
| Flash Point | 116.9±14.8 °C |
| Exact Mass | 185.120453 |
| LogP | 3.02 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.548 |
| InChIKey | TZGPUBAOEMALJE-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)cc(C2(C#N)CCC2)c1 |
| Storage condition | 2-8℃ |
| Cyclobutanecarbonitrile, 1-(3,5-dimethylphenyl)- |
| 1-(3,5-Dimethylphenyl)cyclobutanecarbonitrile |