2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl)
Modify Date: 2026-07-06 21:28:58
2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) structure
|
Common Name | 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) | ||
|---|---|---|---|---|
| CAS Number | 1154331-75-5 | Molecular Weight | 341.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H16INO |
|---|---|
| Molecular Weight | 341.19 |
| InChIKey | OMBGALDHZPNVBF-UHFFFAOYSA-N |
| SMILES | CC(C)NCc1ccc(-c2cccc(I)c2)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl)? |
| A: CAS number of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) is 1154331-75-5. |
| Q: What is the SMILES notation of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl)? |
| A: SMILES notation of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) is CC(C)NCc1ccc(-c2cccc(I)c2)o1. |
| Q: What is the InChIKey of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl)? |
| A: InChIKey of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) is OMBGALDHZPNVBF-UHFFFAOYSA-N. |
| Q: What is the English name of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl)? |
| A: The English name of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) is 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl). |
| Q: What is the molecular weight of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl)? |
| A: Molecular weight of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) is 341.19. |
| Q: What is the molecular formula of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl)? |
| A: Molecular formula of 2-Furanmethanamine, 5-(3-iodophenyl)-N-(1-methylethyl) is C14H16INO. |
| Q: What is the Chinese name of 1154331-75-5? |
| A: Chinese name of 1154331-75-5 is 1154331-75-5. |