5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] structure
|
Common Name | 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] | ||
|---|---|---|---|---|
| CAS Number | 1154579-83-5 | Molecular Weight | 280.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H16N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C17H16N2S |
|---|---|
| Molecular Weight | 280.4 |
| InChIKey | QMOLMNBQTCGJFH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C)c(Sc2ccc(N)c3cccnc23)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1154579-83-5? |
| A: Chinese name of 1154579-83-5 is 1154579-83-5. |
| Q: What is the molecular formula of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio]? |
| A: Molecular formula of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] is C17H16N2S. |
| Q: What is the CAS number of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio]? |
| A: CAS number of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] is 1154579-83-5. |
| Q: What is the InChIKey of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio]? |
| A: InChIKey of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] is QMOLMNBQTCGJFH-UHFFFAOYSA-N. |
| Q: What is the English name of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio]? |
| A: The English name of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] is 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio]. |
| Q: What is the molecular weight of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio]? |
| A: Molecular weight of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] is 280.4. |
| Q: What is the SMILES notation of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio]? |
| A: SMILES notation of 5-Quinolinamine, 8-[(2,5-dimethylphenyl)thio] is Cc1ccc(C)c(Sc2ccc(N)c3cccnc23)c1. |