(d(CH2)51,Tyr(Me)2,Thr4,Orn8,des-Gly-NH29)-Vasotocin trifluoroacetate salt structure
|
Common Name | (d(CH2)51,Tyr(Me)2,Thr4,Orn8,des-Gly-NH29)-Vasotocin trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 115499-13-3 | Molecular Weight | 992.21 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C45H69N9O12S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (d(CH2)51,Tyr(Me)2,Thr4,Orn8,des-Gly-NH29)-Vasotocin trifluoroacetate salt(d(CH2)51,Tyr(Me)2,Thr4,Orn8,des-Gly-NH29)-Vasotocin, an oxytocin receptor antagonist, abolishes oxytocin-enhanced inhibitory postsynaptic currents in CA1 pyramidal neurons[1]. |
| Name | Methyl N-[(2-thioxocyclohexyl)acetyl]-L-tyrosyl-L-isoleucyl-L-thr eonyl-L-asparaginyl-L-cysteinyl-L-prolyl-L-ornithinate |
|---|---|
| Synonym | More Synonyms |
| Description | (d(CH2)51,Tyr(Me)2,Thr4,Orn8,des-Gly-NH29)-Vasotocin, an oxytocin receptor antagonist, abolishes oxytocin-enhanced inhibitory postsynaptic currents in CA1 pyramidal neurons[1]. |
|---|---|
| Related Catalog |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C45H69N9O12S2 |
| Molecular Weight | 992.21 |
| Exact Mass | 991.450684 |
| PSA | 423.60000 |
| LogP | 1.11 |
| Index of Refraction | 1.615 |
| InChIKey | GTCCRRPRDFVDJK-YMZDKENSSA-N |
| SMILES | CCC(C)C(NC(=O)C(Cc1ccc(O)cc1)NC(=O)CC1CCCCC1=S)C(=O)NC(C(=O)NC(CC(N)=O)C(=O)NC(CS)C(=O)N1CCCC1C(=O)NC(CCCN)C(=O)OC)C(C)O |
| L-Ornithine, N-[2-(2-thioxocyclohexyl)acetyl]-L-tyrosyl-L-isoleucyl-L-threonyl-L-asparaginyl-L-cysteinyl-L-prolyl-, methyl ester |
| des-4-fluoro-benzyl-mosapride |
| M-1 Cpd |
| desGly-NH2(9),d(CH2)5[Tyr(Me)2,Thr4]OVT |
| 4-Amino-5-chloro-2-ethoxy-N-((2-morpholinyl)methyl)benzamide |
| Benzamide,4-amino-5-chloro-2-ethoxy-N-(2-morpholinylmethyl) |
| Methyl N-[(2-thioxocyclohexyl)acetyl]-L-tyrosyl-L-isoleucyl-L-threonyl-L-asparaginyl-L-cysteinyl-L-prolyl-L-ornithinate |