N-[2-(3-chloro-4-methoxyphenyl)ethyl]benzamide structure
|
Common Name | N-[2-(3-chloro-4-methoxyphenyl)ethyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 115514-67-5 | Molecular Weight | 289.75700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(3-chloro-4-methoxyphenyl)ethyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H16ClNO2 |
|---|---|
| Molecular Weight | 289.75700 |
| Exact Mass | 289.08700 |
| PSA | 41.82000 |
| LogP | 3.89590 |
| InChIKey | BWPSRGOPTUJDSC-UHFFFAOYSA-N |
| SMILES | COc1ccc(CCNC(=O)c2ccccc2)cc1Cl |
|
~%
N-[2-(3-chloro-... CAS#:115514-67-5 |
| Literature: Charifson; Wyrick; Hoffman; Ademe Simmons; Bowen; McDougald; Mailman Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 1941 - 1946 |
|
~%
N-[2-(3-chloro-... CAS#:115514-67-5 |
| Literature: Charifson; Wyrick; Hoffman; Ademe Simmons; Bowen; McDougald; Mailman Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 1941 - 1946 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| N-benzoyl-3-chloro-4-methoxyphenethylamine |