1,3-Butylene glycol dibenzoate, (3R)
Modify Date: 2026-07-16 19:55:54
1,3-Butylene glycol dibenzoate, (3R) structure
|
Common Name | 1,3-Butylene glycol dibenzoate, (3R) | ||
|---|---|---|---|---|
| CAS Number | 1155350-63-2 | Molecular Weight | 298.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,3-Butylene glycol dibenzoate, (3R) |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H18O4 |
|---|---|
| Molecular Weight | 298.3 |
| InChIKey | HVWZDMVPWXVEBP-CQSZACIVSA-N |
| SMILES | CC(CCOC(=O)c1ccccc1)OC(=O)c1ccccc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1,3-Butylene glycol dibenzoate, (3R)? |
| A: The English name of 1,3-Butylene glycol dibenzoate, (3R) is 1,3-Butylene glycol dibenzoate, (3R). |
| Q: What is the Chinese name of 1155350-63-2? |
| A: Chinese name of 1155350-63-2 is 1155350-63-2. |
| Q: What is the molecular formula of 1,3-Butylene glycol dibenzoate, (3R)? |
| A: Molecular formula of 1,3-Butylene glycol dibenzoate, (3R) is C18H18O4. |
| Q: What is the InChIKey of 1,3-Butylene glycol dibenzoate, (3R)? |
| A: InChIKey of 1,3-Butylene glycol dibenzoate, (3R) is HVWZDMVPWXVEBP-CQSZACIVSA-N. |
| Q: What is the molecular weight of 1,3-Butylene glycol dibenzoate, (3R)? |
| A: Molecular weight of 1,3-Butylene glycol dibenzoate, (3R) is 298.3. |
| Q: What is the CAS number of 1,3-Butylene glycol dibenzoate, (3R)? |
| A: CAS number of 1,3-Butylene glycol dibenzoate, (3R) is 1155350-63-2. |
| Q: What is the SMILES notation of 1,3-Butylene glycol dibenzoate, (3R)? |
| A: SMILES notation of 1,3-Butylene glycol dibenzoate, (3R) is CC(CCOC(=O)c1ccccc1)OC(=O)c1ccccc1. |