damascate structure
|
Common Name | damascate | ||
|---|---|---|---|---|
| CAS Number | 115724-27-1 | Molecular Weight | 212.32800 | |
| Density | 0.92g/cm3 | Boiling Point | 239.6ºC at 760mmHg | |
| Molecular Formula | C13H24O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 102.8ºC | |
| Name | (2-tert-butyl-4-methylcyclohexyl) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.92g/cm3 |
|---|---|
| Boiling Point | 239.6ºC at 760mmHg |
| Molecular Formula | C13H24O2 |
| Molecular Weight | 212.32800 |
| Flash Point | 102.8ºC |
| Exact Mass | 212.17800 |
| PSA | 26.30000 |
| LogP | 3.40040 |
| Vapour Pressure | 0.0398mmHg at 25°C |
| Index of Refraction | 1.452 |
| InChIKey | CQAJCSVXUQEABC-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1CCC(C)CC1C(C)(C)C |
| HS Code | 2915390090 |
|---|
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| 2-tert-Butyl-4-methyl-cyclohexyl acetate |
| Damascate |