[[iodo-(4-methoxyphenyl)silyl]-bis(trimethylsilyl)methyl]-trimethylsilane structure
|
Common Name | [[iodo-(4-methoxyphenyl)silyl]-bis(trimethylsilyl)methyl]-trimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 115820-49-0 | Molecular Weight | 494.70600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H35IOSi4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [[iodo-(4-methoxyphenyl)silyl]-bis(trimethylsilyl)methyl]-trimethylsilane |
|---|
| Molecular Formula | C17H35IOSi4 |
|---|---|
| Molecular Weight | 494.70600 |
| Exact Mass | 494.08100 |
| PSA | 9.23000 |
| LogP | 5.43360 |
| InChIKey | DLDWUMVTPMOXHO-UHFFFAOYSA-N |
| SMILES | COc1ccc([SiH](I)C([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)cc1 |
|
~61%
[[iodo-(4-metho... CAS#:115820-49-0 |
| Literature: Azarian, Davoud B.; Eaborn, Colin; Lickiss, Paul D. Journal of Organometallic Chemistry, 1987 , vol. 330, p. 1 - 8 |
|
~%
[[iodo-(4-metho... CAS#:115820-49-0 |
| Literature: Azarian, Davoud B.; Eaborn, Colin; Lickiss, Paul D. Journal of Organometallic Chemistry, 1987 , vol. 330, p. 1 - 8 |
|
~%
[[iodo-(4-metho... CAS#:115820-49-0 |
| Literature: Azarian, Davoud B.; Eaborn, Colin; Lickiss, Paul D. Journal of Organometallic Chemistry, 1987 , vol. 330, p. 1 - 8 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |