5-ap-2'-dCTP·xTEA structure
|
Common Name | 5-ap-2'-dCTP·xTEA | ||
|---|---|---|---|---|
| CAS Number | 115899-39-3 | Molecular Weight | 520.219 | |
| Density | 2.2±0.1 g/cm3 | Boiling Point | 836.0±75.0 °C at 760 mmHg | |
| Molecular Formula | C12H19N4O13P3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 459.4±37.1 °C | |
Use of 5-ap-2'-dCTP·xTEA5-Propargylamino-dCTP is a nucleoside molecule extracted from patent US9035035B2, compound dCTP-PA. 5-Propargylamino-dCTP can conjugate to molecular markers for use in nucleic acid labeling or sequence analysis[1]. |
| Name | 5-(3-Amino-1-propyn-1-yl)-2'-deoxycytidine 5'-(tetrahydrogen triphosphate) |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Propargylamino-dCTP is a nucleoside molecule extracted from patent US9035035B2, compound dCTP-PA. 5-Propargylamino-dCTP can conjugate to molecular markers for use in nucleic acid labeling or sequence analysis[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 2.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 836.0±75.0 °C at 760 mmHg |
| Molecular Formula | C12H19N4O13P3 |
| Molecular Weight | 520.219 |
| Flash Point | 459.4±37.1 °C |
| Exact Mass | 520.016174 |
| LogP | -4.80 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.744 |
| InChIKey | LVTQIVFSMGDIPF-IVZWLZJFSA-N |
| SMILES | NCC#Cc1cn(C2CC(O)C(COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O2)c(=O)nc1N |
| 5-(3-Amino-1-propyn-1-yl)-2'-deoxycytidine 5'-(tetrahydrogen triphosphate) |
| Cytidine, 5-(3-amino-1-propyn-1-yl)-2'-deoxy-, 5'-(tetrahydrogen triphosphate) |
| MFCD28010326 |
| 5-ap-2'-dCTP·xTEA |