2-chloro-5-[2-(dimethylamino)ethyl]-11H-benzo[b][1,4]benzodiazepin-6-one structure
|
Common Name | 2-chloro-5-[2-(dimethylamino)ethyl]-11H-benzo[b][1,4]benzodiazepin-6-one | ||
|---|---|---|---|---|
| CAS Number | 1159-93-9 | Molecular Weight | 315.79700 | |
| Density | 1.227g/cm3 | Boiling Point | 490ºC at 760mmHg | |
| Molecular Formula | C17H18ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.1ºC | |
| Name | 2-chloro-5-[2-(dimethylamino)ethyl]-11H-benzo[b][1,4]benzodiazepin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.227g/cm3 |
|---|---|
| Boiling Point | 490ºC at 760mmHg |
| Molecular Formula | C17H18ClN3O |
| Molecular Weight | 315.79700 |
| Flash Point | 250.1ºC |
| Exact Mass | 315.11400 |
| PSA | 41.03000 |
| LogP | 3.26000 |
| Vapour Pressure | 9.5E-10mmHg at 25°C |
| Index of Refraction | 1.6 |
| InChIKey | IDWVKNARDDZONS-UHFFFAOYSA-N |
| SMILES | CN(C)CCN1C(=O)c2ccccc2Nc2cc(Cl)ccc21 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,7-Diazabicyclo[2.2.0]heptane,7-chloro |
| 1,7-Diazabicyclo[2.2.1]heptane,7-chloro |
| 7-chloro-10-(2-dimethylamino-ethyl)-5,10-dihydro-dibenzo[b,e][1,4]diazepin-11-one |
| clobenzepam |
| 7-chloro-1,7-diazabicyclo-[2.2.1]heptane |