[(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-chlorooxolan-2-yl]methanol structure
|
Common Name | [(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-chlorooxolan-2-yl]methanol | ||
|---|---|---|---|---|
| CAS Number | 115913-80-9 | Molecular Weight | 269.68800 | |
| Density | 1.88g/cm3 | Boiling Point | 591.5ºC at 760mmHg | |
| Molecular Formula | C10H12ClN5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 311.5ºC | |
| Name | [(2S,4S,5R)-5-(6-aminopurin-9-yl)-4-chlorooxolan-2-yl]methanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.88g/cm3 |
|---|---|
| Boiling Point | 591.5ºC at 760mmHg |
| Molecular Formula | C10H12ClN5O2 |
| Molecular Weight | 269.68800 |
| Flash Point | 311.5ºC |
| Exact Mass | 269.06800 |
| PSA | 99.08000 |
| LogP | 0.87690 |
| Vapour Pressure | 7.73E-15mmHg at 25°C |
| Index of Refraction | 1.831 |
| InChIKey | RHPYWNXOKZLKEM-JFWOZONXSA-N |
| SMILES | Nc1ncnc2c1ncn2C1OC(CO)CC1Cl |
|
~36%
[(2S,4S,5R)-5-(... CAS#:115913-80-9 |
| Literature: Herdewijn; Balzarini; Baba; Pauwels; Van Aerschot; Janssen; De Clerq Journal of Medicinal Chemistry, 1988 , vol. 31, # 10 p. 2040 - 2048 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 2'-ClddA |
| 2'-Chloro-2',3'-dideoxyadenosine threo |