4-(2-hydroxyphenyl)-4-methylpent-2-enoic acid structure
|
Common Name | 4-(2-hydroxyphenyl)-4-methylpent-2-enoic acid | ||
|---|---|---|---|---|
| CAS Number | 115941-82-7 | Molecular Weight | 206.23800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(2-hydroxyphenyl)-4-methylpent-2-enoic acid |
|---|
| Molecular Formula | C12H14O3 |
|---|---|
| Molecular Weight | 206.23800 |
| Exact Mass | 206.09400 |
| PSA | 57.53000 |
| LogP | 2.31060 |
| InChIKey | SKURDBHBCWOQKB-UHFFFAOYSA-N |
| SMILES | CC(C)(C=CC(=O)O)c1ccccc1O |
|
~%
4-(2-hydroxyphe... CAS#:115941-82-7 |
| Literature: Amyes, Tina L.; Kirby, Anthony J. Journal of the American Chemical Society, 1988 , vol. 110, # 19 p. 6505 - 6514 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |