Sulfabrom
Modify Date: 2026-08-06 18:38:32
Sulfabrom structure
|
Common Name | Sulfabrom | ||
|---|---|---|---|---|
| CAS Number | 116-45-0 | Molecular Weight | 357.22600 | |
| Density | 1.653g/cm3 | Boiling Point | 568.3ºC at 760 mmHg | |
| Molecular Formula | C12H13BrN4O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 297.5ºC | |
Use of SulfabromSulfabrom (N 3517; Sulfabromomethazine) is a long-acting veterinary medicine that is used for the treatment of coccidiosis and various bacterial infections in the poultry, swine and cattle. |
| Name | 4-amino-N-(5-bromo-4,6-dimethylpyrimidin-2-yl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfabrom (N 3517; Sulfabromomethazine) is a long-acting veterinary medicine that is used for the treatment of coccidiosis and various bacterial infections in the poultry, swine and cattle. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.653g/cm3 |
|---|---|
| Boiling Point | 568.3ºC at 760 mmHg |
| Molecular Formula | C12H13BrN4O2S |
| Molecular Weight | 357.22600 |
| Flash Point | 297.5ºC |
| Exact Mass | 355.99400 |
| PSA | 106.35000 |
| LogP | 3.97390 |
| Vapour Pressure | 6.23E-13mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | KWXCNODTHBHSIQ-UHFFFAOYSA-N |
| SMILES | Cc1nc(NS(=O)(=O)c2ccc(N)cc2)nc(C)c1Br |
| Storage condition | 2-8℃ |
| WGK Germany | 2 |
|---|---|
| Packaging Group | III |
| HS Code | 2935009090 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
|
Name: qHTS assay to identify small molecule antagonists of the androgen receptor (AR) signa...
Source: 824
Target: AR protein [Homo sapiens]
External Id: MDAN535
|
|
Name: qHTS for Inhibitors of human tyrosyl-DNA phosphodiesterase 1 (TDP1): qHTS in cells in...
Source: NCGC
Target: TDP1 protein [Homo sapiens]
External Id: TDP1100
|
|
Name: qHTS for Inhibitors of human tyrosyl-DNA phosphodiesterase 1 (TDP1): qHTS in cells in...
Source: NCGC
Target: TDP1 protein [Homo sapiens]
External Id: TDP1101
|
|
Name: qHTS assay to identify small molecule antagonists of the androgen receptor (AR) sign...
Source: 824
Target: N/A
External Id: MDAV150
|
|
Name: Cytotoxicity counterscreen for inhibitors of SARS-CoV-2 cell entry
Source: NCGC
Target: N/A
External Id: TRND-SARS-CoV-2-cytotox-48hr
|
|
Name: qHTS assay for small molecules that induce genotoxicity in human embryonic kidney cel...
Source: 824
Target: RecName: Full=ATPase family AAA domain-containing protein 5; AltName: Full=Chromosome fragility-associated gene 1 protein
External Id: ELG271
|
|
Name: Primary qHTS to identify inhibitors of SARS-CoV-2 cell entry
Source: NCGC
External Id: TRND-SARS-CoV-2-PP
|
|
Name: qHTS assay to identify small molecule antagonists of the thyroid receptor (TR) signal...
Source: 824
Target: thyroid hormone receptor beta isoform 2 [Rattus norvegicus]
External Id: TRN186
|
|
Name: qHTS assay to identify small molecule antagonists of the thyroid receptor (TR) signal...
Source: 824
Target: N/A
External Id: TRV455
|
|
Name: S16 Schwann cell viability assay (CellTiter-Glo assay)
Source: NCGC
Target: N/A
External Id: cmt-p4-fda-celltiter_regid
|
Total 69, Current Page 1 of 7
1
2
3
4
5
| Bromosulfamethazine |
| S. N. 3517 |
| 2-sulfanilamide-5-bromo-4,6-dimethyl pyrimidine |
| sulfabromomethazine |
| 5-Bromosulfamethazine |
| EINECS 204-142-6 |
| Sulfabrom |
| Sulfabromomethazine sodium |