3-Bromophthalic acid
3-Bromophthalic acid structure
|
Common Name | 3-Bromophthalic acid | ||
|---|---|---|---|---|
| CAS Number | 116-69-8 | Molecular Weight | 245.027 | |
| Density | 1.9±0.1 g/cm3 | Boiling Point | 408.8±40.0 °C at 760 mmHg | |
| Molecular Formula | C8H5BrO4 | Melting Point | 183-184ºC | |
| MSDS | N/A | Flash Point | 201.1±27.3 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-bromophthalic acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.9±0.1 g/cm3 |
|---|---|
| Boiling Point | 408.8±40.0 °C at 760 mmHg |
| Melting Point | 183-184ºC |
| Molecular Formula | C8H5BrO4 |
| Molecular Weight | 245.027 |
| Flash Point | 201.1±27.3 °C |
| Exact Mass | 243.937119 |
| PSA | 74.60000 |
| LogP | 1.11 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | OIGFNQRFPUUACU-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cccc(Br)c1C(=O)O |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917399090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 10 | |
|---|---|
| DownStream 5 | |
CAS#:76006-33-2
CAS#:576-23-8
CAS#:526-75-0
CAS#:64726-13-2
CAS#:116632-05-4
CAS#:603-11-2
CAS#:5328-76-7
CAS#:7351-74-8
CAS#:15115-60-3
CAS#:86-57-7
CAS#:105694-44-8
CAS#:82-73-5
CAS#:70478-63-6
CAS#:102308-43-0
CAS#:58749-33-0This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917399090 |
|---|---|
| Summary | 2917399090 aromatic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-bromophthalide |
| SC3841 |
| bromophthalic acid |
| 3-bromo-phthalic acid |
| 3-Bromophthalic acid |
| 3-Bromphthalsaeure |
| bromobenzenedicarboxylic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the melting point of 3-bromophthalic acid? |
| A: Melting point of 3-bromophthalic acid is 183-184ºC. |
| Q: What is the InChIKey of 3-bromophthalic acid? |
| A: InChIKey of 3-bromophthalic acid is OIGFNQRFPUUACU-UHFFFAOYSA-N. |
| Q: What is the LogP of 3-bromophthalic acid? |
| A: LogP of 3-bromophthalic acid is 1.11. |
| Q: What is the CAS number of 3-bromophthalic acid? |
| A: CAS number of 3-bromophthalic acid is 116-69-8. |
| Q: What are the upstream materials of 3-bromophthalic acid? |
| A: Related upstream materials(CAS) of 3-bromophthalic acid: 76006-33-2;576-23-8;526-75-0;64726-13-2;116632-05-4;603-11-2;5328-76-7;7351-74-8;15115-60-3;86-57-7. |
| Q: What English synonyms does 3-bromophthalic acid have? |
| A: English synonyms of 3-bromophthalic acid: 3-bromophthalide, SC3841, bromophthalic acid, 3-bromo-phthalic acid, 3-Bromophthalic acid, 3-Bromphthalsaeure, bromobenzenedicarboxylic acid. |
| Q: What is the molecular weight of 3-bromophthalic acid? |
| A: Molecular weight of 3-bromophthalic acid is 245.027. |
| Q: What is the SMILES notation of 3-bromophthalic acid? |
| A: SMILES notation of 3-bromophthalic acid is O=C(O)c1cccc(Br)c1C(=O)O. |
| Q: What is the molecular formula of 3-bromophthalic acid? |
| A: Molecular formula of 3-bromophthalic acid is C8H5BrO4. |
| Q: What is the polar surface area (PSA) of 3-bromophthalic acid? |
| A: Polar surface area (PSA) of 3-bromophthalic acid is 74.60000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |