2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate
Modify Date: 2026-08-16 22:55:50
2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate structure
|
Common Name | 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate | ||
|---|---|---|---|---|
| CAS Number | 116015-75-9 | Molecular Weight | 282.6 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H6Cl3NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H6Cl3NOS |
|---|---|
| Molecular Weight | 282.6 |
| InChIKey | RYJRHOJNEPNDON-UHFFFAOYSA-N |
| SMILES | N#CSCCOc1c(Cl)cc(Cl)cc1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate? |
| A: The English name of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate is 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate. |
| Q: What is the CAS number of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate? |
| A: CAS number of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate is 116015-75-9. |
| Q: What is the SMILES notation of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate? |
| A: SMILES notation of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate is N#CSCCOc1c(Cl)cc(Cl)cc1Cl. |
| Q: What is the molecular formula of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate? |
| A: Molecular formula of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate is C9H6Cl3NOS. |
| Q: What is the InChIKey of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate? |
| A: InChIKey of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate is RYJRHOJNEPNDON-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate? |
| A: Molecular weight of 2-(2,4,6-Trichlorophenoxy)ethyl thiocyanate is 282.6. |
| Q: What is the Chinese name of 116015-75-9? |
| A: Chinese name of 116015-75-9 is 116015-75-9. |